C17H18BrNO5 — CID 22681448
N-[[3-bromo-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]hydroxylamine (PubChem CID 22681448) has the molecular formula C17H18BrNO5 and a molecular weight of 396.24 g/mol. Its IUPAC name is N-[[3-bromo-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]hydroxylamine.
| Compound Name | N-[[3-bromo-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 22681448 |
| Molecular Formula | C17H18BrNO5 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-[[3-bromo-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]hydroxylamine |
| SMILES | COc1cccc(OCCOc2c(Br)cc(C=NO)cc2OC)c1 |
| InChI | InChI=1S/C17H18BrNO5/c1-21-13-4-3-5-14(10-13)23-6-7-24-17-15(18)8-12(11-19-20)9-16(17)22-2/h3-5,8-11,20H,6-7H2,1-2H3 |
| InChIKey | DLDGANMPQAAMNY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|