C9H13N4+ — CID 172510521
(diaminomethylideneamino)-[(4-methylphenyl)methylidene]azanium (PubChem CID 172510521) has the molecular formula C9H13N4+ and a molecular weight of 177.23 g/mol. Its IUPAC name is (diaminomethylideneamino)-[(4-methylphenyl)methylidene]azanium.
| Compound Name | (diaminomethylideneamino)-[(4-methylphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 172510521 |
| Molecular Formula | C9H13N4+ |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | (diaminomethylideneamino)-[(4-methylphenyl)methylidene]azanium |
| SMILES | Cc1ccc(C=[NH+]N=C(N)N)cc1 |
| InChI | InChI=1S/C9H12N4/c1-7-2-4-8(5-3-7)6-12-13-9(10)11/h2-6H,1H3,(H4,10,11,13)/p+1 |
| InChIKey | APQYJFMBVORRMT-UHFFFAOYSA-O |
| XLogP | -1.32 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|