C11H15F2N4O+ — CID 11935922
(Z)-(diaminomethylideneamino)-[[4-(difluoromethoxy)-3,5-dimethylphenyl]methylidene]azanium (PubChem CID 11935922) has the molecular formula C11H15F2N4O+ and a molecular weight of 257.26 g/mol. Its IUPAC name is (Z)-(diaminomethylideneamino)-[[4-(difluoromethoxy)-3,5-dimethylphenyl]methylidene]azanium.
| Compound Name | (Z)-(diaminomethylideneamino)-[[4-(difluoromethoxy)-3,5-dimethylphenyl]methylidene]azanium |
|---|---|
| PubChem CID | 11935922 |
| Molecular Formula | C11H15F2N4O+ |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (Z)-(diaminomethylideneamino)-[[4-(difluoromethoxy)-3,5-dimethylphenyl]methylidene]azanium |
| SMILES | Cc1cc(/C=[NH+]\N=C(N)N)cc(C)c1OC(F)F |
| InChI | InChI=1S/C11H14F2N4O/c1-6-3-8(5-16-17-11(14)15)4-7(2)9(6)18-10(12)13/h3-5,10H,1-2H3,(H4,14,15,17)/p+1/b16-5- |
| InChIKey | OOXXTUJCDCSQJC-BNCCVWRVSA-O |
| XLogP | -0.41 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|