C10H8F2O3 — CID 171027705
4-(difluoromethoxy)-5-methylbenzene-1,3-dicarbaldehyde (PubChem CID 171027705) has the molecular formula C10H8F2O3 and a molecular weight of 214.17 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-methylbenzene-1,3-dicarbaldehyde.
| Compound Name | 4-(difluoromethoxy)-5-methylbenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 171027705 |
| Molecular Formula | C10H8F2O3 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 4-(difluoromethoxy)-5-methylbenzene-1,3-dicarbaldehyde |
| SMILES | Cc1cc(C=O)cc(C=O)c1OC(F)F |
| InChI | InChI=1S/C10H8F2O3/c1-6-2-7(4-13)3-8(5-14)9(6)15-10(11)12/h2-5,10H,1H3 |
| InChIKey | JIAWMSINHZEJAT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|