C10H7F3O5 — CID 171026260
2-[2-(difluoromethoxy)-5-fluoro-3-formylphenyl]-2-hydroxyacetic acid (PubChem CID 171026260) has the molecular formula C10H7F3O5 and a molecular weight of 264.15 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)-5-fluoro-3-formylphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(difluoromethoxy)-5-fluoro-3-formylphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 171026260 |
| Molecular Formula | C10H7F3O5 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2-[2-(difluoromethoxy)-5-fluoro-3-formylphenyl]-2-hydroxyacetic acid |
| SMILES | O=Cc1cc(F)cc(C(O)C(=O)O)c1OC(F)F |
| InChI | InChI=1S/C10H7F3O5/c11-5-1-4(3-14)8(18-10(12)13)6(2-5)7(15)9(16)17/h1-3,7,10,15H,(H,16,17) |
| InChIKey | DXMVEJYAKFMQDG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|