C12H18BN4O4+ — CID 140931997
(3-borono-5-formyl-4-propoxyphenyl)methylidene-(diaminomethylideneamino)azanium (PubChem CID 140931997) has the molecular formula C12H18BN4O4+ and a molecular weight of 293.11 g/mol. Its IUPAC name is (3-borono-5-formyl-4-propoxyphenyl)methylidene-(diaminomethylideneamino)azanium.
| Compound Name | (3-borono-5-formyl-4-propoxyphenyl)methylidene-(diaminomethylideneamino)azanium |
|---|---|
| PubChem CID | 140931997 |
| Molecular Formula | C12H18BN4O4+ |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (3-borono-5-formyl-4-propoxyphenyl)methylidene-(diaminomethylideneamino)azanium |
| SMILES | CCCOc1c(C=O)cc(C=[NH+]N=C(N)N)cc1B(O)O |
| InChI | InChI=1S/C12H17BN4O4/c1-2-3-21-11-9(7-18)4-8(5-10(11)13(19)20)6-16-17-12(14)15/h4-7,19-20H,2-3H2,1H3,(H4,14,15,17)/p+1 |
| InChIKey | UFOVUHCBQOITCV-UHFFFAOYSA-O |
| XLogP | -3.34 |
| TPSA | 145.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|