C16H28Cl2N8O2 — CID 45263357
2-[(E)-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2,3-dipropoxyphenyl]methylideneamino]guanidine;dihydrochloride (PubChem CID 45263357) has the molecular formula C16H28Cl2N8O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is 2-[(E)-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2,3-dipropoxyphenyl]methylideneamino]guanidine;dihydrochloride.
| Compound Name | 2-[(E)-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2,3-dipropoxyphenyl]methylideneamino]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 45263357 |
| Molecular Formula | C16H28Cl2N8O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-[(E)-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2,3-dipropoxyphenyl]methylideneamino]guanidine;dihydrochloride |
| SMILES | CCCOc1c(/C=N/N=C(N)N)ccc(/C=N/N=C(N)N)c1OCCC.Cl.Cl |
| InChI | InChI=1S/C16H26N8O2.2ClH/c1-3-7-25-13-11(9-21-23-15(17)18)5-6-12(10-22-24-16(19)20)14(13)26-8-4-2;;/h5-6,9-10H,3-4,7-8H2,1-2H3,(H4,17,18,23)(H4,19,20,24);2*1H/b21-9+,22-10+;; |
| InChIKey | YOCXUJMKGWZGOC-DEXCEPPTSA-N |
| XLogP | 1.32 |
| TPSA | 171.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|