C17H19N4O3+ — CID 11921634
(Z)-(diaminomethylideneamino)-[[4-[(4-methoxycarbonylphenyl)methoxy]phenyl]methylidene]azanium (PubChem CID 11921634) has the molecular formula C17H19N4O3+ and a molecular weight of 327.36 g/mol. Its IUPAC name is (Z)-(diaminomethylideneamino)-[[4-[(4-methoxycarbonylphenyl)methoxy]phenyl]methylidene]azanium.
| Compound Name | (Z)-(diaminomethylideneamino)-[[4-[(4-methoxycarbonylphenyl)methoxy]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 11921634 |
| Molecular Formula | C17H19N4O3+ |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (Z)-(diaminomethylideneamino)-[[4-[(4-methoxycarbonylphenyl)methoxy]phenyl]methylidene]azanium |
| SMILES | COC(=O)c1ccc(COc2ccc(/C=[NH+]\N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C17H18N4O3/c1-23-16(22)14-6-2-13(3-7-14)11-24-15-8-4-12(5-9-15)10-20-21-17(18)19/h2-10H,11H2,1H3,(H4,18,19,21)/p+1/b20-10- |
| InChIKey | KTCJZYRBQXPEDD-JMIUGGIZSA-O |
| XLogP | -0.26 |
| TPSA | 113.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|