C15H17N4O3S+ — CID 11864095
(Z)-(diaminomethylideneamino)-[[2-(4-methylphenyl)sulfonyloxyphenyl]methylidene]azanium (PubChem CID 11864095) has the molecular formula C15H17N4O3S+ and a molecular weight of 333.39 g/mol. Its IUPAC name is (Z)-(diaminomethylideneamino)-[[2-(4-methylphenyl)sulfonyloxyphenyl]methylidene]azanium.
| Compound Name | (Z)-(diaminomethylideneamino)-[[2-(4-methylphenyl)sulfonyloxyphenyl]methylidene]azanium |
|---|---|
| PubChem CID | 11864095 |
| Molecular Formula | C15H17N4O3S+ |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (Z)-(diaminomethylideneamino)-[[2-(4-methylphenyl)sulfonyloxyphenyl]methylidene]azanium |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2/C=[NH+]\N=C(N)N)cc1 |
| InChI | InChI=1S/C15H16N4O3S/c1-11-6-8-13(9-7-11)23(20,21)22-14-5-3-2-4-12(14)10-18-19-15(16)17/h2-10H,1H3,(H4,16,17,19)/p+1/b18-10- |
| InChIKey | KCHFGJOXPLWNIY-ZDLGFXPLSA-O |
| XLogP | -0.55 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|