C18H23N4O+ — CID 135678668
(Z)-4-(azepan-1-ium-1-yl)-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile (PubChem CID 135678668) has the molecular formula C18H23N4O+ and a molecular weight of 311.41 g/mol. Its IUPAC name is (Z)-4-(azepan-1-ium-1-yl)-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile.
| Compound Name | (Z)-4-(azepan-1-ium-1-yl)-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 135678668 |
| Molecular Formula | C18H23N4O+ |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (Z)-4-(azepan-1-ium-1-yl)-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
| SMILES | Cn1c(/C(C#N)=C(\O)C[NH+]2CCCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C18H22N4O/c1-21-16-9-5-4-8-15(16)20-18(21)14(12-19)17(23)13-22-10-6-2-3-7-11-22/h4-5,8-9,23H,2-3,6-7,10-11,13H2,1H3/p+1/b17-14- |
| InChIKey | UGBINCXWLWYEMO-VKAVYKQESA-O |
| XLogP | 1.82 |
| TPSA | 66.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|