C19H24N4O — CID 135678667
(Z)-4-[cyclohexyl(methyl)amino]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile (PubChem CID 135678667) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is (Z)-4-[cyclohexyl(methyl)amino]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile.
| Compound Name | (Z)-4-[cyclohexyl(methyl)amino]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 135678667 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (Z)-4-[cyclohexyl(methyl)amino]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
| SMILES | CN(C/C(O)=C(\C#N)c1nc2ccccc2n1C)C1CCCCC1 |
| InChI | InChI=1S/C19H24N4O/c1-22(14-8-4-3-5-9-14)13-18(24)15(12-20)19-21-16-10-6-7-11-17(16)23(19)2/h6-7,10-11,14,24H,3-5,8-9,13H2,1-2H3/b18-15- |
| InChIKey | MCGGTNMHMOSULD-SDXDJHTJSA-N |
| XLogP | 3.63 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|