C23H17N3O — CID 135521654
(Z)-3-hydroxy-2-(1-methylbenzimidazol-2-yl)-3-(4-phenylphenyl)prop-2-enenitrile (PubChem CID 135521654) has the molecular formula C23H17N3O and a molecular weight of 351.41 g/mol. Its IUPAC name is (Z)-3-hydroxy-2-(1-methylbenzimidazol-2-yl)-3-(4-phenylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-hydroxy-2-(1-methylbenzimidazol-2-yl)-3-(4-phenylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135521654 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (Z)-3-hydroxy-2-(1-methylbenzimidazol-2-yl)-3-(4-phenylphenyl)prop-2-enenitrile |
| SMILES | Cn1c(/C(C#N)=C(\O)c2ccc(-c3ccccc3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C23H17N3O/c1-26-21-10-6-5-9-20(21)25-23(26)19(15-24)22(27)18-13-11-17(12-14-18)16-7-3-2-4-8-16/h2-14,27H,1H3/b22-19- |
| InChIKey | BWBXLEVKCFXPNQ-QOCHGBHMSA-N |
| XLogP | 5.19 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|