C21H20N4O4S — CID 3449525
3-hydroxy-2-(1-methylbenzimidazol-2-yl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enenitrile (PubChem CID 3449525) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is 3-hydroxy-2-(1-methylbenzimidazol-2-yl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enenitrile.
| Compound Name | 3-hydroxy-2-(1-methylbenzimidazol-2-yl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3449525 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-hydroxy-2-(1-methylbenzimidazol-2-yl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enenitrile |
| SMILES | Cn1c(C(C#N)=C(O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C21H20N4O4S/c1-24-19-5-3-2-4-18(19)23-21(24)17(14-22)20(26)15-6-8-16(9-7-15)30(27,28)25-10-12-29-13-11-25/h2-9,26H,10-13H2,1H3 |
| InChIKey | WXLVXHVONRNBJB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|