C12H8BrF2N3O — CID 4702453
4-bromo-4,4-difluoro-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile (PubChem CID 4702453) has the molecular formula C12H8BrF2N3O and a molecular weight of 328.12 g/mol. Its IUPAC name is 4-bromo-4,4-difluoro-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile.
| Compound Name | 4-bromo-4,4-difluoro-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 4702453 |
| Molecular Formula | C12H8BrF2N3O |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 4-bromo-4,4-difluoro-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
| SMILES | Cn1c(C(C#N)=C(O)C(F)(F)Br)nc2ccccc21 |
| InChI | InChI=1S/C12H8BrF2N3O/c1-18-9-5-3-2-4-8(9)17-11(18)7(6-16)10(19)12(13,14)15/h2-5,19H,1H3 |
| InChIKey | PWSQTGZWGFBWRB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|