C18H22N4O — CID 4982560
3-hydroxy-2-(1-methylbenzimidazol-2-yl)-4-(3-methylpiperidin-1-yl)but-2-enenitrile (PubChem CID 4982560) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-hydroxy-2-(1-methylbenzimidazol-2-yl)-4-(3-methylpiperidin-1-yl)but-2-enenitrile.
| Compound Name | 3-hydroxy-2-(1-methylbenzimidazol-2-yl)-4-(3-methylpiperidin-1-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 4982560 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3-hydroxy-2-(1-methylbenzimidazol-2-yl)-4-(3-methylpiperidin-1-yl)but-2-enenitrile |
| SMILES | CC1CCCN(CC(O)=C(C#N)c2nc3ccccc3n2C)C1 |
| InChI | InChI=1S/C18H22N4O/c1-13-6-5-9-22(11-13)12-17(23)14(10-19)18-20-15-7-3-4-8-16(15)21(18)2/h3-4,7-8,13,23H,5-6,9,11-12H2,1-2H3 |
| InChIKey | XYDOVNLKFANTKF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|