C23H25N5O2 — CID 135779711
(Z)-3-hydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile (PubChem CID 135779711) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is (Z)-3-hydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile.
| Compound Name | (Z)-3-hydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 135779711 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (Z)-3-hydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
| SMILES | COc1ccc(N2CCN(C/C(O)=C(\C#N)c3nc4ccccc4n3C)CC2)cc1 |
| InChI | InChI=1S/C23H25N5O2/c1-26-21-6-4-3-5-20(21)25-23(26)19(15-24)22(29)16-27-11-13-28(14-12-27)17-7-9-18(30-2)10-8-17/h3-10,29H,11-14,16H2,1-2H3/b22-19- |
| InChIKey | SAWVJPFKJLXKHA-QOCHGBHMSA-N |
| XLogP | 3.20 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|