C18H20N4O2 — CID 135842102
(Z)-3-hydroxy-4-(3-methylpiperidin-1-yl)-2-(4-oxo-3H-quinazolin-2-yl)but-2-enenitrile (PubChem CID 135842102) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is (Z)-3-hydroxy-4-(3-methylpiperidin-1-yl)-2-(4-oxo-3H-quinazolin-2-yl)but-2-enenitrile.
| Compound Name | (Z)-3-hydroxy-4-(3-methylpiperidin-1-yl)-2-(4-oxo-3H-quinazolin-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 135842102 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (Z)-3-hydroxy-4-(3-methylpiperidin-1-yl)-2-(4-oxo-3H-quinazolin-2-yl)but-2-enenitrile |
| SMILES | CC1CCCN(C/C(O)=C(\C#N)c2nc3ccccc3c(=O)[nH]2)C1 |
| InChI | InChI=1S/C18H20N4O2/c1-12-5-4-8-22(10-12)11-16(23)14(9-19)17-20-15-7-3-2-6-13(15)18(24)21-17/h2-3,6-7,12,23H,4-5,8,10-11H2,1H3,(H,20,21,24)/b16-14- |
| InChIKey | LLJHBLMREAKMEM-PEZBUJJGSA-N |
| XLogP | 2.45 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|