C12H13N5OS — CID 29310629
3-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylpropanenitrile (PubChem CID 29310629) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 3-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylpropanenitrile.
| Compound Name | 3-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylpropanenitrile |
|---|---|
| PubChem CID | 29310629 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylpropanenitrile |
| SMILES | CCOc1ccccc1-n1nnnc1SCCC#N |
| InChI | InChI=1S/C12H13N5OS/c1-2-18-11-7-4-3-6-10(11)17-12(14-15-16-17)19-9-5-8-13/h3-4,6-7H,2,5,9H2,1H3 |
| InChIKey | MVAIUWYSDIVWEL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|