C16H15ClN4OS — CID 2614031
5-[(4-chlorophenyl)methylsulfanyl]-1-(2-ethoxyphenyl)tetrazole (PubChem CID 2614031) has the molecular formula C16H15ClN4OS and a molecular weight of 346.84 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylsulfanyl]-1-(2-ethoxyphenyl)tetrazole.
| Compound Name | 5-[(4-chlorophenyl)methylsulfanyl]-1-(2-ethoxyphenyl)tetrazole |
|---|---|
| PubChem CID | 2614031 |
| Molecular Formula | C16H15ClN4OS |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 5-[(4-chlorophenyl)methylsulfanyl]-1-(2-ethoxyphenyl)tetrazole |
| SMILES | CCOc1ccccc1-n1nnnc1SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN4OS/c1-2-22-15-6-4-3-5-14(15)21-16(18-19-20-21)23-11-12-7-9-13(17)10-8-12/h3-10H,2,11H2,1H3 |
| InChIKey | ICUTURIJDYAIJD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |