C22H18BrN5O2S — CID 137301020
(E)-4-(6-bromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile (PubChem CID 137301020) has the molecular formula C22H18BrN5O2S and a molecular weight of 496.39 g/mol. Its IUPAC name is (E)-4-(6-bromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile.
| Compound Name | (E)-4-(6-bromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 137301020 |
| Molecular Formula | C22H18BrN5O2S |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | (E)-4-(6-bromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
| SMILES | CCn1c(SC/C(O)=C(/C#N)c2nc3ccccc3n2C)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C22H18BrN5O2S/c1-3-28-21(30)14-10-13(23)8-9-16(14)26-22(28)31-12-19(29)15(11-24)20-25-17-6-4-5-7-18(17)27(20)2/h4-10,29H,3,12H2,1-2H3/b19-15+ |
| InChIKey | GVCPAYRAKPDNFS-XDJHFCHBSA-N |
| XLogP | 4.65 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|