C19H16N6O2S2 — CID 137281077
(Z)-4-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile (PubChem CID 137281077) has the molecular formula C19H16N6O2S2 and a molecular weight of 424.51 g/mol. Its IUPAC name is (Z)-4-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile.
| Compound Name | (Z)-4-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 137281077 |
| Molecular Formula | C19H16N6O2S2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (Z)-4-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
| SMILES | Cn1c(/C(C#N)=C(\O)CSc2nnc(NCc3ccco3)s2)nc2ccccc21 |
| InChI | InChI=1S/C19H16N6O2S2/c1-25-15-7-3-2-6-14(15)22-17(25)13(9-20)16(26)11-28-19-24-23-18(29-19)21-10-12-5-4-8-27-12/h2-8,26H,10-11H2,1H3,(H,21,23)/b16-13- |
| InChIKey | UESKNJMUYYMLBC-SSZFMOIBSA-N |
| XLogP | 4.21 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|