C19H19FN2OS2 — CID 7905980
2-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 7905980) has the molecular formula C19H19FN2OS2 and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7905980 |
| Molecular Formula | C19H19FN2OS2 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(S[C@H](C)c2ccc(F)cc2)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C19H19FN2OS2/c1-5-10-22-18(23)16-11(2)12(3)24-17(16)21-19(22)25-13(4)14-6-8-15(20)9-7-14/h5-9,13H,1,10H2,2-4H3/t13-/m1/s1 |
| InChIKey | BBQHEDDKAREPIH-CYBMUJFWSA-N |
| XLogP | 5.25 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|