C15H19N5S2 — CID 87009391
5,6-dimethyl-2-[3-(1-methylpyrazol-4-yl)propylsulfanyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 87009391) has the molecular formula C15H19N5S2 and a molecular weight of 333.49 g/mol. Its IUPAC name is 5,6-dimethyl-2-[3-(1-methylpyrazol-4-yl)propylsulfanyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-2-[3-(1-methylpyrazol-4-yl)propylsulfanyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 87009391 |
| Molecular Formula | C15H19N5S2 |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5,6-dimethyl-2-[3-(1-methylpyrazol-4-yl)propylsulfanyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(SCCCc3cnn(C)c3)nc(N)c2c1C |
| InChI | InChI=1S/C15H19N5S2/c1-9-10(2)22-14-12(9)13(16)18-15(19-14)21-6-4-5-11-7-17-20(3)8-11/h7-8H,4-6H2,1-3H3,(H2,16,18,19) |
| InChIKey | NNVLPQJAGCEJRX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|