C15H18N4S2 — CID 87037559
5,6-dimethyl-4-[3-(1-methylpyrazol-4-yl)propylsulfanyl]thieno[2,3-d]pyrimidine (PubChem CID 87037559) has the molecular formula C15H18N4S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 5,6-dimethyl-4-[3-(1-methylpyrazol-4-yl)propylsulfanyl]thieno[2,3-d]pyrimidine.
| Compound Name | 5,6-dimethyl-4-[3-(1-methylpyrazol-4-yl)propylsulfanyl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 87037559 |
| Molecular Formula | C15H18N4S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5,6-dimethyl-4-[3-(1-methylpyrazol-4-yl)propylsulfanyl]thieno[2,3-d]pyrimidine |
| SMILES | Cc1sc2ncnc(SCCCc3cnn(C)c3)c2c1C |
| InChI | InChI=1S/C15H18N4S2/c1-10-11(2)21-15-13(10)14(16-9-17-15)20-6-4-5-12-7-18-19(3)8-12/h7-9H,4-6H2,1-3H3 |
| InChIKey | IFIDSVAMUOAMRE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|