C20H23N3OS2 — CID 5238223
N-(2,6-dimethylphenyl)-4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbutanamide (PubChem CID 5238223) has the molecular formula C20H23N3OS2 and a molecular weight of 385.56 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbutanamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 5238223 |
| Molecular Formula | C20H23N3OS2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbutanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCCSc1ncnc2sc(C)c(C)c12 |
| InChI | InChI=1S/C20H23N3OS2/c1-12-7-5-8-13(2)18(12)23-16(24)9-6-10-25-19-17-14(3)15(4)26-20(17)22-11-21-19/h5,7-8,11H,6,9-10H2,1-4H3,(H,23,24) |
| InChIKey | FHSKFVGPUXSVJO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|