C19H21N3OS2 — CID 2390487
2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-(3-phenylpropyl)acetamide (PubChem CID 2390487) has the molecular formula C19H21N3OS2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 2390487 |
| Molecular Formula | C19H21N3OS2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-(3-phenylpropyl)acetamide |
| SMILES | Cc1sc2ncnc(SCC(=O)NCCCc3ccccc3)c2c1C |
| InChI | InChI=1S/C19H21N3OS2/c1-13-14(2)25-19-17(13)18(21-12-22-19)24-11-16(23)20-10-6-9-15-7-4-3-5-8-15/h3-5,7-8,12H,6,9-11H2,1-2H3,(H,20,23) |
| InChIKey | LZEHYKBTOKOWJM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|