C13H19ClN4OS2 — CID 119503357
2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-[2-(methylamino)ethyl]acetamide;hydrochloride (PubChem CID 119503357) has the molecular formula C13H19ClN4OS2 and a molecular weight of 346.91 g/mol. Its IUPAC name is 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-[2-(methylamino)ethyl]acetamide;hydrochloride.
| Compound Name | 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-[2-(methylamino)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119503357 |
| Molecular Formula | C13H19ClN4OS2 |
| Molecular Weight | 346.91 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-[2-(methylamino)ethyl]acetamide;hydrochloride |
| SMILES | CNCCNC(=O)CSc1ncnc2sc(C)c(C)c12.Cl |
| InChI | InChI=1S/C13H18N4OS2.ClH/c1-8-9(2)20-13-11(8)12(16-7-17-13)19-6-10(18)15-5-4-14-3;/h7,14H,4-6H2,1-3H3,(H,15,18);1H |
| InChIKey | OJCHXCPOUUJRKM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.91 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|