C18H18N4OS2 — CID 42983658
3-[3-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropyl]-1H-benzimidazol-2-one (PubChem CID 42983658) has the molecular formula C18H18N4OS2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 3-[3-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropyl]-1H-benzimidazol-2-one.
| Compound Name | 3-[3-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 42983658 |
| Molecular Formula | C18H18N4OS2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-[3-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropyl]-1H-benzimidazol-2-one |
| SMILES | Cc1sc2ncnc(SCCCn3c(=O)[nH]c4ccccc43)c2c1C |
| InChI | InChI=1S/C18H18N4OS2/c1-11-12(2)25-17-15(11)16(19-10-20-17)24-9-5-8-22-14-7-4-3-6-13(14)21-18(22)23/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,21,23) |
| InChIKey | SZLVUZWMWXIWGF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|