C16H16N2O3S3 — CID 8521928
phenyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanesulfonate (PubChem CID 8521928) has the molecular formula C16H16N2O3S3 and a molecular weight of 380.52 g/mol. Its IUPAC name is phenyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanesulfonate.
| Compound Name | phenyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanesulfonate |
|---|---|
| PubChem CID | 8521928 |
| Molecular Formula | C16H16N2O3S3 |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | phenyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanesulfonate |
| SMILES | Cc1sc2ncnc(SCCS(=O)(=O)Oc3ccccc3)c2c1C |
| InChI | InChI=1S/C16H16N2O3S3/c1-11-12(2)23-16-14(11)15(17-10-18-16)22-8-9-24(19,20)21-13-6-4-3-5-7-13/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | AWWPFYPZDVWETK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|