C17H22N2O2S2 — CID 97067184
2-[(1R,2R)-2-hydroxycyclohexyl]sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 97067184) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-[(1R,2R)-2-hydroxycyclohexyl]sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(1R,2R)-2-hydroxycyclohexyl]sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 97067184 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-[(1R,2R)-2-hydroxycyclohexyl]sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(S[C@@H]2CCCC[C@H]2O)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C17H22N2O2S2/c1-4-9-19-16(21)14-10(2)11(3)22-15(14)18-17(19)23-13-8-6-5-7-12(13)20/h4,12-13,20H,1,5-9H2,2-3H3/t12-,13-/m1/s1 |
| InChIKey | HNUDOOHXSFTJHO-CHWSQXEVSA-N |
| XLogP | 3.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|