C21H15N7S2 — CID 2042803
2-[[10-(4-methylphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methylsulfanyl]-1,3-benzothiazole (PubChem CID 2042803) has the molecular formula C21H15N7S2 and a molecular weight of 429.53 g/mol. Its IUPAC name is 2-[[10-(4-methylphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methylsulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[[10-(4-methylphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 2042803 |
| Molecular Formula | C21H15N7S2 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-[[10-(4-methylphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methylsulfanyl]-1,3-benzothiazole |
| SMILES | Cc1ccc(-n2ncc3c2ncn2nc(CSc4nc5ccccc5s4)nc32)cc1 |
| InChI | InChI=1S/C21H15N7S2/c1-13-6-8-14(9-7-13)28-19-15(10-23-28)20-25-18(26-27(20)12-22-19)11-29-21-24-16-4-2-3-5-17(16)30-21/h2-10,12H,11H2,1H3 |
| InChIKey | JHNRUVFPNYKYGQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |