C23H27N7O2 — CID 29057368
(Z)-N-[[11,12-dimethyl-10-(2-morpholin-4-ylethyl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]-1-phenylmethanimine (PubChem CID 29057368) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is (Z)-N-[[11,12-dimethyl-10-(2-morpholin-4-ylethyl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]-1-phenylmethanimine.
| Compound Name | (Z)-N-[[11,12-dimethyl-10-(2-morpholin-4-ylethyl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]-1-phenylmethanimine |
|---|---|
| PubChem CID | 29057368 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (Z)-N-[[11,12-dimethyl-10-(2-morpholin-4-ylethyl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]-1-phenylmethanimine |
| SMILES | Cc1c(C)n(CCN2CCOCC2)c2ncn3nc(CO/N=C\c4ccccc4)nc3c12 |
| InChI | InChI=1S/C23H27N7O2/c1-17-18(2)29(9-8-28-10-12-31-13-11-28)22-21(17)23-26-20(27-30(23)16-24-22)15-32-25-14-19-6-4-3-5-7-19/h3-7,14,16H,8-13,15H2,1-2H3/b25-14- |
| InChIKey | AMRPBGMQDWRMQP-QFEZKATASA-N |
| XLogP | 2.58 |
| TPSA | 82.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|