C15H24N6O — CID 68530635
[5,6-dimethyl-7-(3-morpholin-4-ylpropyl)pyrrolo[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 68530635) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is [5,6-dimethyl-7-(3-morpholin-4-ylpropyl)pyrrolo[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [5,6-dimethyl-7-(3-morpholin-4-ylpropyl)pyrrolo[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 68530635 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [5,6-dimethyl-7-(3-morpholin-4-ylpropyl)pyrrolo[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1c(C)n(CCCN2CCOCC2)c2ncnc(NN)c12 |
| InChI | InChI=1S/C15H24N6O/c1-11-12(2)21(5-3-4-20-6-8-22-9-7-20)15-13(11)14(19-16)17-10-18-15/h10H,3-9,16H2,1-2H3,(H,17,18,19) |
| InChIKey | MLDAYAVMTHFOPT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|