C17H30N5+ — CID 7641893
3-[4-(butylamino)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-7-yl]propyl-dimethylazanium (PubChem CID 7641893) has the molecular formula C17H30N5+ and a molecular weight of 304.46 g/mol. Its IUPAC name is 3-[4-(butylamino)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-7-yl]propyl-dimethylazanium.
| Compound Name | 3-[4-(butylamino)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-7-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7641893 |
| Molecular Formula | C17H30N5+ |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 3-[4-(butylamino)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-7-yl]propyl-dimethylazanium |
| SMILES | CCCCNc1ncnc2c1c(C)c(C)n2CCC[NH+](C)C |
| InChI | InChI=1S/C17H29N5/c1-6-7-9-18-16-15-13(2)14(3)22(11-8-10-21(4)5)17(15)20-12-19-16/h12H,6-11H2,1-5H3,(H,18,19,20)/p+1 |
| InChIKey | NUBAUFIBDPNZNB-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 47.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|