C12H16N8 — CID 175603327
N-butyl-9-methyl-8-(triazol-2-yl)purin-6-amine (PubChem CID 175603327) has the molecular formula C12H16N8 and a molecular weight of 272.32 g/mol. Its IUPAC name is N-butyl-9-methyl-8-(triazol-2-yl)purin-6-amine.
| Compound Name | N-butyl-9-methyl-8-(triazol-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 175603327 |
| Molecular Formula | C12H16N8 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-butyl-9-methyl-8-(triazol-2-yl)purin-6-amine |
| SMILES | CCCCNc1ncnc2c1nc(-n1nccn1)n2C |
| InChI | InChI=1S/C12H16N8/c1-3-4-5-13-10-9-11(15-8-14-10)19(2)12(18-9)20-16-6-7-17-20/h6-8H,3-5H2,1-2H3,(H,13,14,15) |
| InChIKey | VFTFRXIOFNGKIG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|