C9H12N8 — CID 172601388
2-azido-N-butylpyrazolo[4,3-d]pyrimidin-7-amine (PubChem CID 172601388) has the molecular formula C9H12N8 and a molecular weight of 232.25 g/mol. Its IUPAC name is 2-azido-N-butylpyrazolo[4,3-d]pyrimidin-7-amine.
| Compound Name | 2-azido-N-butylpyrazolo[4,3-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 172601388 |
| Molecular Formula | C9H12N8 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-azido-N-butylpyrazolo[4,3-d]pyrimidin-7-amine |
| SMILES | CCCCNc1ncnc2cn(N=[N+]=[N-])nc12 |
| InChI | InChI=1S/C9H12N8/c1-2-3-4-11-9-8-7(12-6-13-9)5-17(14-8)16-15-10/h5-6H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | DIXAZNAASZBMGP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|