C8H16N4 — CID 90481031
3-N-butyl-1-methylpyrazole-3,4-diamine (PubChem CID 90481031) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-N-butyl-1-methylpyrazole-3,4-diamine.
| Compound Name | 3-N-butyl-1-methylpyrazole-3,4-diamine |
|---|---|
| PubChem CID | 90481031 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 3-N-butyl-1-methylpyrazole-3,4-diamine |
| SMILES | CCCCNc1nn(C)cc1N |
| InChI | InChI=1S/C8H16N4/c1-3-4-5-10-8-7(9)6-12(2)11-8/h6H,3-5,9H2,1-2H3,(H,10,11) |
| InChIKey | DINRHFIAHGVYIO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|