C11H22N4O — CID 106284296
1-[(4-amino-1-methylpyrazol-3-yl)amino]-3-ethylpentan-2-ol (PubChem CID 106284296) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-[(4-amino-1-methylpyrazol-3-yl)amino]-3-ethylpentan-2-ol.
| Compound Name | 1-[(4-amino-1-methylpyrazol-3-yl)amino]-3-ethylpentan-2-ol |
|---|---|
| PubChem CID | 106284296 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 1-[(4-amino-1-methylpyrazol-3-yl)amino]-3-ethylpentan-2-ol |
| SMILES | CCC(CC)C(O)CNc1nn(C)cc1N |
| InChI | InChI=1S/C11H22N4O/c1-4-8(5-2)10(16)6-13-11-9(12)7-15(3)14-11/h7-8,10,16H,4-6,12H2,1-3H3,(H,13,14) |
| InChIKey | NTLCMGDGPANSEJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |