C9H18ClN3 — CID 126965542
N-butyl-1,3-dimethylpyrazol-4-amine;hydrochloride (PubChem CID 126965542) has the molecular formula C9H18ClN3 and a molecular weight of 203.72 g/mol. Its IUPAC name is N-butyl-1,3-dimethylpyrazol-4-amine;hydrochloride.
| Compound Name | N-butyl-1,3-dimethylpyrazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 126965542 |
| Molecular Formula | C9H18ClN3 |
| Molecular Weight | 203.72 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-butyl-1,3-dimethylpyrazol-4-amine;hydrochloride |
| SMILES | CCCCNc1cn(C)nc1C.Cl |
| InChI | InChI=1S/C9H17N3.ClH/c1-4-5-6-10-9-7-12(3)11-8(9)2;/h7,10H,4-6H2,1-3H3;1H |
| InChIKey | BUKOGLUOKDRTMI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.72 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|