C9H18N4OS — CID 103078897
1-methyl-3-N-(3-methylsulfinylbutyl)pyrazole-3,4-diamine (PubChem CID 103078897) has the molecular formula C9H18N4OS and a molecular weight of 230.34 g/mol. Its IUPAC name is 1-methyl-3-N-(3-methylsulfinylbutyl)pyrazole-3,4-diamine.
| Compound Name | 1-methyl-3-N-(3-methylsulfinylbutyl)pyrazole-3,4-diamine |
|---|---|
| PubChem CID | 103078897 |
| Molecular Formula | C9H18N4OS |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-methyl-3-N-(3-methylsulfinylbutyl)pyrazole-3,4-diamine |
| SMILES | CC(CCNc1nn(C)cc1N)S(C)=O |
| InChI | InChI=1S/C9H18N4OS/c1-7(15(3)14)4-5-11-9-8(10)6-13(2)12-9/h6-7H,4-5,10H2,1-3H3,(H,11,12) |
| InChIKey | NEPOXRLIIPPMEE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |