C19H21N4O3+ — CID 7644080
3-[[5,6-bis(furan-2-yl)furo[2,3-d]pyrimidin-4-yl]amino]propyl-dimethylazanium (PubChem CID 7644080) has the molecular formula C19H21N4O3+ and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-[[5,6-bis(furan-2-yl)furo[2,3-d]pyrimidin-4-yl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[5,6-bis(furan-2-yl)furo[2,3-d]pyrimidin-4-yl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7644080 |
| Molecular Formula | C19H21N4O3+ |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-[[5,6-bis(furan-2-yl)furo[2,3-d]pyrimidin-4-yl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNc1ncnc2oc(-c3ccco3)c(-c3ccco3)c12 |
| InChI | InChI=1S/C19H20N4O3/c1-23(2)9-5-8-20-18-16-15(13-6-3-10-24-13)17(14-7-4-11-25-14)26-19(16)22-12-21-18/h3-4,6-7,10-12H,5,8-9H2,1-2H3,(H,20,21,22)/p+1 |
| InChIKey | PFMILCZJCYKEIP-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|