C20H20N4O4 — CID 4894519
5,6-bis(furan-2-yl)-N-(2-morpholin-4-ylethyl)furo[2,3-d]pyrimidin-4-amine (PubChem CID 4894519) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 5,6-bis(furan-2-yl)-N-(2-morpholin-4-ylethyl)furo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-bis(furan-2-yl)-N-(2-morpholin-4-ylethyl)furo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4894519 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 5,6-bis(furan-2-yl)-N-(2-morpholin-4-ylethyl)furo[2,3-d]pyrimidin-4-amine |
| SMILES | c1coc(-c2oc3ncnc(NCCN4CCOCC4)c3c2-c2ccco2)c1 |
| InChI | InChI=1S/C20H20N4O4/c1-3-14(26-9-1)16-17-19(21-5-6-24-7-11-25-12-8-24)22-13-23-20(17)28-18(16)15-4-2-10-27-15/h1-4,9-10,13H,5-8,11-12H2,(H,21,22,23) |
| InChIKey | GAYRDXLKGVPWSA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |