C19H12N4O3 — CID 4972133
5,6-bis(furan-2-yl)-N-pyridin-4-ylfuro[2,3-d]pyrimidin-4-amine (PubChem CID 4972133) has the molecular formula C19H12N4O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is 5,6-bis(furan-2-yl)-N-pyridin-4-ylfuro[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-bis(furan-2-yl)-N-pyridin-4-ylfuro[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4972133 |
| Molecular Formula | C19H12N4O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 5,6-bis(furan-2-yl)-N-pyridin-4-ylfuro[2,3-d]pyrimidin-4-amine |
| SMILES | c1coc(-c2oc3ncnc(Nc4ccncc4)c3c2-c2ccco2)c1 |
| InChI | InChI=1S/C19H12N4O3/c1-3-13(24-9-1)15-16-18(23-12-5-7-20-8-6-12)21-11-22-19(16)26-17(15)14-4-2-10-25-14/h1-11H,(H,20,21,22,23) |
| InChIKey | XDKGSFFAVWMPEU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |