C21H17N3O2S — CID 10523512
4-anilino-5-(furan-2-yl)-6,7,8,9-tetrahydro-[1,3]oxazino[6,5-b]quinoline-2-thione (PubChem CID 10523512) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-anilino-5-(furan-2-yl)-6,7,8,9-tetrahydro-[1,3]oxazino[6,5-b]quinoline-2-thione.
| Compound Name | 4-anilino-5-(furan-2-yl)-6,7,8,9-tetrahydro-[1,3]oxazino[6,5-b]quinoline-2-thione |
|---|---|
| PubChem CID | 10523512 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 4-anilino-5-(furan-2-yl)-6,7,8,9-tetrahydro-[1,3]oxazino[6,5-b]quinoline-2-thione |
| SMILES | S=c1nc(Nc2ccccc2)c2c(-c3ccco3)c3c(nc2o1)CCCC3 |
| InChI | InChI=1S/C21H17N3O2S/c27-21-24-19(22-13-7-2-1-3-8-13)18-17(16-11-6-12-25-16)14-9-4-5-10-15(14)23-20(18)26-21/h1-3,6-8,11-12H,4-5,9-10H2,(H,22,24,27) |
| InChIKey | YHBBJISXUIIWAT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|