C19H16N4O3 — CID 4969808
4-tert-butyl-11,12-bis(furan-2-yl)-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4969808) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 4-tert-butyl-11,12-bis(furan-2-yl)-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-tert-butyl-11,12-bis(furan-2-yl)-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4969808 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-tert-butyl-11,12-bis(furan-2-yl)-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CC(C)(C)c1nc2c3c(-c4ccco4)c(-c4ccco4)oc3ncn2n1 |
| InChI | InChI=1S/C19H16N4O3/c1-19(2,3)18-21-16-14-13(11-6-4-8-24-11)15(12-7-5-9-25-12)26-17(14)20-10-23(16)22-18/h4-10H,1-3H3 |
| InChIKey | VZLOANMFJLKGTR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 82.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |