C20H17N5O3 — CID 4902274
5,6-bis(furan-2-yl)-N-(3-imidazol-1-ylpropyl)furo[2,3-d]pyrimidin-4-amine (PubChem CID 4902274) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 5,6-bis(furan-2-yl)-N-(3-imidazol-1-ylpropyl)furo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-bis(furan-2-yl)-N-(3-imidazol-1-ylpropyl)furo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4902274 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 5,6-bis(furan-2-yl)-N-(3-imidazol-1-ylpropyl)furo[2,3-d]pyrimidin-4-amine |
| SMILES | c1coc(-c2oc3ncnc(NCCCn4ccnc4)c3c2-c2ccco2)c1 |
| InChI | InChI=1S/C20H17N5O3/c1-4-14(26-10-1)16-17-19(22-6-3-8-25-9-7-21-13-25)23-12-24-20(17)28-18(16)15-5-2-11-27-15/h1-2,4-5,7,9-13H,3,6,8H2,(H,22,23,24) |
| InChIKey | PKJSJVWIBJFUJG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|