C30H22ClN7O2 — CID 98185662
(Z)-N-[[(16S)-16-(4-chlorophenyl)-14-methyl-12-phenyl-10-oxa-3,5,6,8,12,13-hexazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,4,7,11(15),13-hexaen-4-yl]methoxy]-1-phenylmethanimine (PubChem CID 98185662) has the molecular formula C30H22ClN7O2 and a molecular weight of 548.01 g/mol. Its IUPAC name is (Z)-N-[[(16S)-16-(4-chlorophenyl)-14-methyl-12-phenyl-10-oxa-3,5,6,8,12,13-hexazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,4,7,11(15),13-hexaen-4-yl]methoxy]-1-phenylmethanimine.
| Compound Name | (Z)-N-[[(16S)-16-(4-chlorophenyl)-14-methyl-12-phenyl-10-oxa-3,5,6,8,12,13-hexazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,4,7,11(15),13-hexaen-4-yl]methoxy]-1-phenylmethanimine |
|---|---|
| PubChem CID | 98185662 |
| Molecular Formula | C30H22ClN7O2 |
| Molecular Weight | 548.01 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | (Z)-N-[[(16S)-16-(4-chlorophenyl)-14-methyl-12-phenyl-10-oxa-3,5,6,8,12,13-hexazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,4,7,11(15),13-hexaen-4-yl]methoxy]-1-phenylmethanimine |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@H](c1ccc(Cl)cc1)c1c(ncn3nc(CO/N=C\c4ccccc4)nc13)O2 |
| InChI | InChI=1S/C30H22ClN7O2/c1-19-25-26(21-12-14-22(31)15-13-21)27-28-34-24(17-39-33-16-20-8-4-2-5-9-20)36-37(28)18-32-29(27)40-30(25)38(35-19)23-10-6-3-7-11-23/h2-16,18,26H,17H2,1H3/b33-16-/t26-/m0/s1 |
| InChIKey | QTFSAORXMQILBN-YWXNFOLHSA-N |
| XLogP | 6.11 |
| TPSA | 91.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.01 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|