C16H16N6O2 — CID 23605256
4-[(3,4-dimethoxyphenyl)methyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 23605256) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 23605256 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | COc1ccc(Cc2nc3c4cnn(C)c4ncn3n2)cc1OC |
| InChI | InChI=1S/C16H16N6O2/c1-21-15-11(8-18-21)16-19-14(20-22(16)9-17-15)7-10-4-5-12(23-2)13(6-10)24-3/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | GXISDSQYMGPLPZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |