C15H15N7O — CID 19571523
4-methoxy-N-[(10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methyl]aniline (PubChem CID 19571523) has the molecular formula C15H15N7O and a molecular weight of 309.33 g/mol. Its IUPAC name is 4-methoxy-N-[(10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methyl]aniline.
| Compound Name | 4-methoxy-N-[(10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 19571523 |
| Molecular Formula | C15H15N7O |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-methoxy-N-[(10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methyl]aniline |
| SMILES | COc1ccc(NCc2nc3c4cnn(C)c4ncn3n2)cc1 |
| InChI | InChI=1S/C15H15N7O/c1-21-14-12(7-18-21)15-19-13(20-22(15)9-17-14)8-16-10-3-5-11(23-2)6-4-10/h3-7,9,16H,8H2,1-2H3 |
| InChIKey | OCSXOGZOWWOYAG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|