C27H22N6O — CID 19582237
4-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19582237) has the molecular formula C27H22N6O and a molecular weight of 446.51 g/mol. Its IUPAC name is 4-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19582237 |
| Molecular Formula | C27H22N6O |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1cccc(C)c1OCc1ccc(-c2nc3c4cnn(-c5ccccc5)c4ncn3n2)cc1 |
| InChI | InChI=1S/C27H22N6O/c1-18-7-6-8-19(2)24(18)34-16-20-11-13-21(14-12-20)25-30-27-23-15-29-33(22-9-4-3-5-10-22)26(23)28-17-32(27)31-25/h3-15,17H,16H2,1-2H3 |
| InChIKey | WQOLMGIOLKSVQM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |